C26H28N2O2 — CID 57063054
N-(2,6-diethylphenyl)-6-methyl-2-phenyl-4-prop-2-enoxypyridine-3-carboxamide (PubChem CID 57063054) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-6-methyl-2-phenyl-4-prop-2-enoxypyridine-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-6-methyl-2-phenyl-4-prop-2-enoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 57063054 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N-(2,6-diethylphenyl)-6-methyl-2-phenyl-4-prop-2-enoxypyridine-3-carboxamide |
| SMILES | C=CCOc1cc(C)nc(-c2ccccc2)c1C(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C26H28N2O2/c1-5-16-30-22-17-18(4)27-25(21-12-9-8-10-13-21)23(22)26(29)28-24-19(6-2)14-11-15-20(24)7-3/h5,8-15,17H,1,6-7,16H2,2-4H3,(H,28,29) |
| InChIKey | YLGGBFUIHMVYTG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|