C21H23F3N2O2 — CID 57220881
N-(2,6-diethylphenyl)-6-methyl-4-prop-2-enoxy-2-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 57220881) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-6-methyl-4-prop-2-enoxy-2-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-6-methyl-4-prop-2-enoxy-2-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57220881 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-(2,6-diethylphenyl)-6-methyl-4-prop-2-enoxy-2-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | C=CCOc1cc(C)nc(C(F)(F)F)c1C(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C21H23F3N2O2/c1-5-11-28-16-12-13(4)25-19(21(22,23)24)17(16)20(27)26-18-14(6-2)9-8-10-15(18)7-3/h5,8-10,12H,1,6-7,11H2,2-4H3,(H,26,27) |
| InChIKey | JQMAMGGEIDOJCF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|