C19H21F3N2O2 — CID 57308371
4-butoxy-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 57308371) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 4-butoxy-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 4-butoxy-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57308371 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-butoxy-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | CCCCOc1cc(C)nc(C)c1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O2/c1-4-5-9-26-16-10-12(2)23-13(3)17(16)18(25)24-15-8-6-7-14(11-15)19(20,21)22/h6-8,10-11H,4-5,9H2,1-3H3,(H,24,25) |
| InChIKey | VYVWQVUQYKXBQP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|