C28H35NO4S — CID 57063852
methyl 2-[2-[4-(4-butylphenyl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]phenyl]acetate (PubChem CID 57063852) has the molecular formula C28H35NO4S and a molecular weight of 481.66 g/mol. Its IUPAC name is methyl 2-[2-[4-(4-butylphenyl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]phenyl]acetate.
| Compound Name | methyl 2-[2-[4-(4-butylphenyl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]phenyl]acetate |
|---|---|
| PubChem CID | 57063852 |
| Molecular Formula | C28H35NO4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | methyl 2-[2-[4-(4-butylphenyl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)butyl]phenyl]acetate |
| SMILES | CCCCc1ccc(CC(CCc2ccccc2CC(=O)OC)(c2ccc[nH]2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H35NO4S/c1-4-5-9-22-13-15-23(16-14-22)21-28(34(3,31)32,26-12-8-19-29-26)18-17-24-10-6-7-11-25(24)20-27(30)33-2/h6-8,10-16,19,29H,4-5,9,17-18,20-21H2,1-3H3 |
| InChIKey | NBKITXWEENXMCR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |