C23H30N3O6+ — CID 57066751
tert-butyl (2R)-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 57066751) has the molecular formula C23H30N3O6+ and a molecular weight of 444.51 g/mol. Its IUPAC name is tert-butyl (2R)-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]-2-methylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2R)-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57066751 |
| Molecular Formula | C23H30N3O6+ |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | tert-butyl (2R)-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(=O)[N+]2(C(=O)OC(C)(C)C)CCC[C@H]2C)n1 |
| InChI | InChI=1S/C23H30N3O6/c1-15-10-9-13-26(15,22(28)32-23(2,3)4)20(27)16-11-7-8-12-17(16)31-21-24-18(29-5)14-19(25-21)30-6/h7-8,11-12,14-15H,9-10,13H2,1-6H3/q+1/t15-,26?/m1/s1 |
| InChIKey | DVNXDHBOINQYPG-GJNAARLKSA-N |
| XLogP | 4.36 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|