C28H35N3O4 — CID 57067347
2-adamantyl N-[(2S)-3-(2-deuterio-1-oxidopyridin-1-ium-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate (PubChem CID 57067347) has the molecular formula C28H35N3O4 and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-adamantyl N-[(2S)-3-(2-deuterio-1-oxidopyridin-1-ium-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate.
| Compound Name | 2-adamantyl N-[(2S)-3-(2-deuterio-1-oxidopyridin-1-ium-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 57067347 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 2-adamantyl N-[(2S)-3-(2-deuterio-1-oxidopyridin-1-ium-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate |
| SMILES | [2H]c1c(C[C@](C)(NC(=O)OC2C3CC4CC(C3)CC2C4)C(=O)NCCc2ccccc2)ccc[n+]1[O-] |
| InChI | InChI=1S/C28H35N3O4/c1-28(17-20-8-5-11-31(34)18-20,26(32)29-10-9-19-6-3-2-4-7-19)30-27(33)35-25-23-13-21-12-22(15-23)16-24(25)14-21/h2-8,11,18,21-25H,9-10,12-17H2,1H3,(H,29,32)(H,30,33)/t21?,22?,23?,24?,25?,28-/m0/s1/i18D |
| InChIKey | SQUDXWZMPCWYTN-QIRXIHAISA-N |
| XLogP | 3.53 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|