C17H14N2O3S — CID 57068291
2-(benzenecarboximidoyl)-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid (PubChem CID 57068291) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-(benzenecarboximidoyl)-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid.
| Compound Name | 2-(benzenecarboximidoyl)-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 57068291 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-(benzenecarboximidoyl)-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid |
| SMILES | [H]/N=C(\c1ccccc1)c1cc2c(=O)c(C(=O)O)cn(CC)c2s1 |
| InChI | InChI=1S/C17H14N2O3S/c1-2-19-9-12(17(21)22)15(20)11-8-13(23-16(11)19)14(18)10-6-4-3-5-7-10/h3-9,18H,2H2,1H3,(H,21,22)/b18-14+ |
| InChIKey | JCAZDPSGJRRQOE-NBVRZTHBSA-N |
| XLogP | 3.20 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|