C8H14N2O2S3 — CID 57072669
2-tert-butylsulfanyl-5-ethylsulfonyl-1,3,4-thiadiazole (PubChem CID 57072669) has the molecular formula C8H14N2O2S3 and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-5-ethylsulfonyl-1,3,4-thiadiazole.
| Compound Name | 2-tert-butylsulfanyl-5-ethylsulfonyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 57072669 |
| Molecular Formula | C8H14N2O2S3 |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 2-tert-butylsulfanyl-5-ethylsulfonyl-1,3,4-thiadiazole |
| SMILES | CCS(=O)(=O)c1nnc(SC(C)(C)C)s1 |
| InChI | InChI=1S/C8H14N2O2S3/c1-5-15(11,12)7-10-9-6(13-7)14-8(2,3)4/h5H2,1-4H3 |
| InChIKey | FWXAKIUQSMWRTC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |