C4H6N2O6S5 — CID 5121959
[5-(sulfomethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethanesulfonic acid (PubChem CID 5121959) has the molecular formula C4H6N2O6S5 and a molecular weight of 338.44 g/mol. Its IUPAC name is [5-(sulfomethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethanesulfonic acid.
| Compound Name | [5-(sulfomethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethanesulfonic acid |
|---|---|
| PubChem CID | 5121959 |
| Molecular Formula | C4H6N2O6S5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | [5-(sulfomethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethanesulfonic acid |
| SMILES | O=S(=O)(O)CSc1nnc(SCS(=O)(=O)O)s1 |
| InChI | InChI=1S/C4H6N2O6S5/c7-16(8,9)1-13-3-5-6-4(15-3)14-2-17(10,11)12/h1-2H2,(H,7,8,9)(H,10,11,12) |
| InChIKey | IBQDRSQACXROAF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|