C6H6N2NaO2S7+ — CID 54609359
sodium [5-(dithiocarboxyoxymethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethoxymethanedithioic acid (PubChem CID 54609359) has the molecular formula C6H6N2NaO2S7+ and a molecular weight of 385.59 g/mol. Its IUPAC name is sodium [5-(dithiocarboxyoxymethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethoxymethanedithioic acid.
| Compound Name | sodium [5-(dithiocarboxyoxymethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethoxymethanedithioic acid |
|---|---|
| PubChem CID | 54609359 |
| Molecular Formula | C6H6N2NaO2S7+ |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 384.84 |
| IUPAC Name | sodium [5-(dithiocarboxyoxymethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanylmethoxymethanedithioic acid |
| SMILES | S=C(S)OCSc1nnc(SCOC(=S)S)s1.[Na+] |
| InChI | InChI=1S/C6H6N2O2S7.Na/c11-5(12)9-1-15-3-7-8-4(17-3)16-2-10-6(13)14;/h1-2H2,(H,11,12)(H,13,14);/q;+1 |
| InChIKey | YEBKNASCRACVHU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|