C6H8N2O3S3 — CID 57138225
2-[[5-(methylsulfonylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetaldehyde (PubChem CID 57138225) has the molecular formula C6H8N2O3S3 and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[[5-(methylsulfonylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetaldehyde.
| Compound Name | 2-[[5-(methylsulfonylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetaldehyde |
|---|---|
| PubChem CID | 57138225 |
| Molecular Formula | C6H8N2O3S3 |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 2-[[5-(methylsulfonylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetaldehyde |
| SMILES | CS(=O)(=O)Cc1nnc(SCC=O)s1 |
| InChI | InChI=1S/C6H8N2O3S3/c1-14(10,11)4-5-7-8-6(13-5)12-3-2-9/h2H,3-4H2,1H3 |
| InChIKey | VKURRYFFGABLPA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|