C31H38 — CID 570778
1-[1-[2,4-bis(4-methylphenyl)butyl]-4-methylpent-4-enyl]-4-methylbenzene (PubChem CID 570778) has the molecular formula C31H38 and a molecular weight of 410.65 g/mol. Its IUPAC name is 1-[1-[2,4-bis(4-methylphenyl)butyl]-4-methylpent-4-enyl]-4-methylbenzene.
| Compound Name | 1-[1-[2,4-bis(4-methylphenyl)butyl]-4-methylpent-4-enyl]-4-methylbenzene |
|---|---|
| PubChem CID | 570778 |
| Molecular Formula | C31H38 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 1-[1-[2,4-bis(4-methylphenyl)butyl]-4-methylpent-4-enyl]-4-methylbenzene |
| SMILES | C=C(C)CCC(CC(CCc1ccc(C)cc1)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H38/c1-23(2)6-16-30(28-17-9-25(4)10-18-28)22-31(29-19-11-26(5)12-20-29)21-15-27-13-7-24(3)8-14-27/h7-14,17-20,30-31H,1,6,15-16,21-22H2,2-5H3 |
| InChIKey | UWTRSFPCXUXUJI-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|