C13H19N5O4 — CID 57078405
N-(5-ethyl-6-nitro-3-nitrosohept-4-enyl)-1H-imidazole-5-carboxamide (PubChem CID 57078405) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-(5-ethyl-6-nitro-3-nitrosohept-4-enyl)-1H-imidazole-5-carboxamide.
| Compound Name | N-(5-ethyl-6-nitro-3-nitrosohept-4-enyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 57078405 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-(5-ethyl-6-nitro-3-nitrosohept-4-enyl)-1H-imidazole-5-carboxamide |
| SMILES | CCC(=CC(CCNC(=O)c1cnc[nH]1)N=O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N5O4/c1-3-10(9(2)18(21)22)6-11(17-20)4-5-15-13(19)12-7-14-8-16-12/h6-9,11H,3-5H2,1-2H3,(H,14,16)(H,15,19) |
| InChIKey | SGGNIMFZYHBSQL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|