C22H26N2O4 — CID 57080666
4,5-dimethoxy-N-[3-(methylamino)propoxy]-1a-phenyl-1H-cyclopropa[b]chromen-7-amine (PubChem CID 57080666) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 4,5-dimethoxy-N-[3-(methylamino)propoxy]-1a-phenyl-1H-cyclopropa[b]chromen-7-amine.
| Compound Name | 4,5-dimethoxy-N-[3-(methylamino)propoxy]-1a-phenyl-1H-cyclopropa[b]chromen-7-amine |
|---|---|
| PubChem CID | 57080666 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 4,5-dimethoxy-N-[3-(methylamino)propoxy]-1a-phenyl-1H-cyclopropa[b]chromen-7-amine |
| SMILES | CNCCCONC1=C2CC2(c2ccccc2)Oc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C22H26N2O4/c1-23-10-7-11-27-24-21-16-12-19(25-2)20(26-3)13-18(16)28-22(14-17(21)22)15-8-5-4-6-9-15/h4-6,8-9,12-13,23-24H,7,10-11,14H2,1-3H3 |
| InChIKey | IQNXSGATDIQFOQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|