C17H16F3N — CID 57083255
4-[4-(trifluoromethyl)phenyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine (PubChem CID 57083255) has the molecular formula C17H16F3N and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine |
|---|---|
| PubChem CID | 57083255 |
| Molecular Formula | C17H16F3N |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine |
| SMILES | [H]/N=C1\C=C2C=CCCC2C(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H16F3N/c18-17(19,20)13-7-5-11(6-8-13)16-10-14(21)9-12-3-1-2-4-15(12)16/h1,3,5-9,15-16,21H,2,4,10H2/b21-14+ |
| InChIKey | SDDUSAGWZBRBMH-KGENOOAVSA-N |
| XLogP | 5.11 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|