C14H17ClN2O4 — CID 57084115
2-acetamidoethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate (PubChem CID 57084115) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is 2-acetamidoethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate.
| Compound Name | 2-acetamidoethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
|---|---|
| PubChem CID | 57084115 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-acetamidoethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
| SMILES | C=C(NOCC(=O)OCCNC(C)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O4/c1-10(12-3-5-13(15)6-4-12)17-21-9-14(19)20-8-7-16-11(2)18/h3-6,17H,1,7-9H2,2H3,(H,16,18) |
| InChIKey | VEMBZFLBWRPZFI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|