C15H21ClN2O3 — CID 57178648
1-(dimethylamino)propan-2-yl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate (PubChem CID 57178648) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-(dimethylamino)propan-2-yl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate.
| Compound Name | 1-(dimethylamino)propan-2-yl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
|---|---|
| PubChem CID | 57178648 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(dimethylamino)propan-2-yl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
| SMILES | C=C(NOCC(=O)OC(C)CN(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-11(9-18(3)4)21-15(19)10-20-17-12(2)13-5-7-14(16)8-6-13/h5-8,11,17H,2,9-10H2,1,3-4H3 |
| InChIKey | UJVRCHBPCRWVGA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|