C17H23ClN2O3 — CID 57208828
(1,4-dimethylpiperidin-4-yl) 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate (PubChem CID 57208828) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is (1,4-dimethylpiperidin-4-yl) 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate.
| Compound Name | (1,4-dimethylpiperidin-4-yl) 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
|---|---|
| PubChem CID | 57208828 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (1,4-dimethylpiperidin-4-yl) 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
| SMILES | C=C(NOCC(=O)OC1(C)CCN(C)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-13(14-4-6-15(18)7-5-14)19-22-12-16(21)23-17(2)8-10-20(3)11-9-17/h4-7,19H,1,8-12H2,2-3H3 |
| InChIKey | XBEQLSWNOBAHJB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|