About 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate
2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate (PubChem CID 57311494) has the molecular formula C17H23ClN2O3
and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
| PubChem CID | 57311494 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
| SMILES | C=C(NOCC(=O)OCCN1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-14(15-5-7-16(18)8-6-15)19-23-13-17(21)22-12-11-20-9-3-2-4-10-20/h5-8,19H,1-4,9-13H2 |
| InChIKey | QKKLLMUVFCOUOG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
The IUPAC name of 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate (CID 57311494) is 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate.
What is the SMILES notation for 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
The canonical SMILES for 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate is C=C(NOCC(=O)OCCN1CCCCC1)c1ccc(Cl)cc1.
What is the InChIKey of 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
The InChIKey is QKKLLMUVFCOUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN2O3/c1-14(15-5-7-16(18)8-6-15)19-23-13-17(21)22-12-11-20-9-3-2-4-10-20/h5-8,19H,1-4,9-13H2.
What are the key properties of 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate has a molecular weight of 338.84 g/mol, XLogP of 2.86, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate is sourced from PubChem (CID 57311494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).