About 1-phenylazetidin-2-one
1-phenylazetidin-2-one (PubChem CID 570854) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-phenylazetidin-2-one.
Molecular Properties
| Compound Name | 1-phenylazetidin-2-one |
| PubChem CID | 570854 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-phenylazetidin-2-one |
| SMILES | O=C1CCN1c1ccccc1 |
| InChI | InChI=1S/C9H9NO/c11-9-6-7-10(9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | OPISVEPYALEQJT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylazetidin-2-one?
The IUPAC name of 1-phenylazetidin-2-one (CID 570854) is 1-phenylazetidin-2-one.
What is the SMILES notation for 1-phenylazetidin-2-one?
The canonical SMILES for 1-phenylazetidin-2-one is O=C1CCN1c1ccccc1.
What is the InChIKey of 1-phenylazetidin-2-one?
The InChIKey is OPISVEPYALEQJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c11-9-6-7-10(9)8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 1-phenylazetidin-2-one?
1-phenylazetidin-2-one has a molecular weight of 147.18 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylazetidin-2-one is sourced from PubChem (CID 570854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).