About Formamide, N-ethyl-N-phenyl-
Formamide, N-ethyl-N-phenyl- (PubChem CID 79585) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is N-ethyl-N-phenylformamide.
Molecular Properties
| Compound Name | Formamide, N-ethyl-N-phenyl- |
| PubChem CID | 79585 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-ethyl-N-phenylformamide |
| SMILES | CCN(C=O)C1=CC=CC=C1 |
| InChI | InChI=1S/C9H11NO/c1-2-10(8-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | GBDYFPAHVXJQEP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 119 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze Formamide, N-ethyl-N-phenyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Formamide, N-ethyl-N-phenyl-?
The IUPAC name of Formamide, N-ethyl-N-phenyl- (CID 79585) is N-ethyl-N-phenylformamide.
What is the SMILES notation for Formamide, N-ethyl-N-phenyl-?
The canonical SMILES for Formamide, N-ethyl-N-phenyl- is CCN(C=O)C1=CC=CC=C1.
What is the InChIKey of Formamide, N-ethyl-N-phenyl-?
The InChIKey is GBDYFPAHVXJQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-10(8-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3.
What are the key properties of Formamide, N-ethyl-N-phenyl-?
Formamide, N-ethyl-N-phenyl- has a molecular weight of 149.19 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Formamide, N-ethyl-N-phenyl- is sourced from PubChem (CID 79585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).