C17H11ClF4N2O3S — CID 57088038
4-[1-(3-chloro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-fluorobenzenesulfinic acid (PubChem CID 57088038) has the molecular formula C17H11ClF4N2O3S and a molecular weight of 434.80 g/mol. Its IUPAC name is 4-[1-(3-chloro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-fluorobenzenesulfinic acid.
| Compound Name | 4-[1-(3-chloro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-fluorobenzenesulfinic acid |
|---|---|
| PubChem CID | 57088038 |
| Molecular Formula | C17H11ClF4N2O3S |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 4-[1-(3-chloro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-fluorobenzenesulfinic acid |
| SMILES | COc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(S(=O)O)c(F)c2)cc1Cl |
| InChI | InChI=1S/C17H11ClF4N2O3S/c1-27-14-4-3-10(7-11(14)18)24-13(8-16(23-24)17(20,21)22)9-2-5-15(28(25)26)12(19)6-9/h2-8H,1H3,(H,25,26) |
| InChIKey | YVZMMWWASKQSSI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|