C22H29ClNO4S+ — CID 57089452
[4-chloro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate (PubChem CID 57089452) has the molecular formula C22H29ClNO4S+ and a molecular weight of 439.00 g/mol. Its IUPAC name is [4-chloro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-chloro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57089452 |
| Molecular Formula | C22H29ClNO4S+ |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [4-chloro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[N+]2(c3ccc(OC(C)(C)C)cc3)CCC(Cl)CC2)cc1 |
| InChI | InChI=1S/C22H29ClNO4S/c1-17-5-11-21(12-6-17)29(25,26)28-24(15-13-18(23)14-16-24)19-7-9-20(10-8-19)27-22(2,3)4/h5-12,18H,13-16H2,1-4H3/q+1 |
| InChIKey | VXQSPOCPCLVBBG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|