C18H28NO3S+ — CID 90997856
(1,4-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate (PubChem CID 90997856) has the molecular formula C18H28NO3S+ and a molecular weight of 338.49 g/mol. Its IUPAC name is (1,4-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,4-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90997856 |
| Molecular Formula | C18H28NO3S+ |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (1,4-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[N+]2(C)CCC(C)C3CCCCC32)cc1 |
| InChI | InChI=1S/C18H28NO3S/c1-14-8-10-16(11-9-14)23(20,21)22-19(3)13-12-15(2)17-6-4-5-7-18(17)19/h8-11,15,17-18H,4-7,12-13H2,1-3H3/q+1 |
| InChIKey | FZBPXPJGLIEJLD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|