C23H29ClNO3S+ — CID 91026776
(4-chloro-1-methyl-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate (PubChem CID 91026776) has the molecular formula C23H29ClNO3S+ and a molecular weight of 435.01 g/mol. Its IUPAC name is (4-chloro-1-methyl-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (4-chloro-1-methyl-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91026776 |
| Molecular Formula | C23H29ClNO3S+ |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (4-chloro-1-methyl-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-1-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[N+]2(C)C(c3ccccc3)CC(Cl)C3CCCCC32)cc1 |
| InChI | InChI=1S/C23H29ClNO3S/c1-17-12-14-19(15-13-17)29(26,27)28-25(2)22-11-7-6-10-20(22)21(24)16-23(25)18-8-4-3-5-9-18/h3-5,8-9,12-15,20-23H,6-7,10-11,16H2,1-2H3/q+1 |
| InChIKey | ZBONPWJUSIAQMD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|