C10H16F2 — CID 57092135
4,4-difluorobut-3-enylcyclohexane (PubChem CID 57092135) has the molecular formula C10H16F2 and a molecular weight of 174.23 g/mol. Its IUPAC name is 4,4-difluorobut-3-enylcyclohexane.
| Compound Name | 4,4-difluorobut-3-enylcyclohexane |
|---|---|
| PubChem CID | 57092135 |
| Molecular Formula | C10H16F2 |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4,4-difluorobut-3-enylcyclohexane |
| SMILES | FC(F)=CCCC1CCCCC1 |
| InChI | InChI=1S/C10H16F2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h8-9H,1-7H2 |
| InChIKey | UXZVLMIEHYHZSC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |