C16H24N2O4 — CID 57097105
5-[5-(3-methylcyclohexyl)-2,4,6-trioxo-1,3-diazinan-5-yl]pentanal (PubChem CID 57097105) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 5-[5-(3-methylcyclohexyl)-2,4,6-trioxo-1,3-diazinan-5-yl]pentanal.
| Compound Name | 5-[5-(3-methylcyclohexyl)-2,4,6-trioxo-1,3-diazinan-5-yl]pentanal |
|---|---|
| PubChem CID | 57097105 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 5-[5-(3-methylcyclohexyl)-2,4,6-trioxo-1,3-diazinan-5-yl]pentanal |
| SMILES | CC1CCCC(C2(CCCCC=O)C(=O)NC(=O)NC2=O)C1 |
| InChI | InChI=1S/C16H24N2O4/c1-11-6-5-7-12(10-11)16(8-3-2-4-9-19)13(20)17-15(22)18-14(16)21/h9,11-12H,2-8,10H2,1H3,(H2,17,18,20,21,22) |
| InChIKey | JLMYBKPMEHWIIC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|