C30H39N3O4 — CID 57098930
benzyl (1S,2R,4S,5S,8S,9R,11S)-2-[[(2S)-2-azidopropoxy]methyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate (PubChem CID 57098930) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is benzyl (1S,2R,4S,5S,8S,9R,11S)-2-[[(2S)-2-azidopropoxy]methyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate.
| Compound Name | benzyl (1S,2R,4S,5S,8S,9R,11S)-2-[[(2S)-2-azidopropoxy]methyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate |
|---|---|
| PubChem CID | 57098930 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | benzyl (1S,2R,4S,5S,8S,9R,11S)-2-[[(2S)-2-azidopropoxy]methyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate |
| SMILES | CC(C)C1=C[C@@H]2C[C@@]3(C=O)[C@H]4CC[C@H](C)[C@@H]4C[C@]2(COC[C@H](C)N=[N+]=[N-])[C@@]13C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H39N3O4/c1-19(2)26-12-23-13-28(17-34)25-11-10-20(3)24(25)14-29(23,18-36-15-21(4)32-33-31)30(26,28)27(35)37-16-22-8-6-5-7-9-22/h5-9,12,17,19-21,23-25H,10-11,13-16,18H2,1-4H3/t20-,21-,23+,24-,25-,28+,29+,30+/m0/s1 |
| InChIKey | GAEKNDSLXSOYEZ-ZAXUQEOPSA-N |
| XLogP | 6.29 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|