C39H53O9Si — CID 18703972
CID 18703972 (PubChem CID 18703972) has the molecular formula C39H53O9Si and a molecular weight of 693.93 g/mol.
| Compound Name | CID 18703972 |
|---|---|
| PubChem CID | 18703972 |
| Molecular Formula | C39H53O9Si |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.35 |
| IUPAC Name | — |
| SMILES | CC(C)C1=CC2CC3(C=O)C4CCC(C)C4CC2(COC24OC5C(OCc6ccccc6)C(OC5(O[Si](C)C)O2)C4C(C)(C)C)C13C(=O)O |
| InChI | InChI=1S/C39H53O9Si/c1-22(2)28-16-25-17-35(20-40)27-15-14-23(3)26(27)18-36(25,37(28,35)33(41)42)21-44-38-31(34(4,5)6)29-30(43-19-24-12-10-9-11-13-24)32(46-38)39(45-29,47-38)48-49(7)8/h9-13,16,20,22-23,25-27,29-32H,14-15,17-19,21H2,1-8H3,(H,41,42) |
| InChIKey | RMXVUOAZKJCWAE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|