C30H48O4 — CID 57289620
(1S,2R,4S,5S,8S,9R,11S)-2-(decoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 57289620) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is (1S,2R,4S,5S,8S,9R,11S)-2-(decoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | (1S,2R,4S,5S,8S,9R,11S)-2-(decoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 57289620 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (1S,2R,4S,5S,8S,9R,11S)-2-(decoxymethyl)-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CCCCCCCCCCOC[C@]12C[C@H]3[C@@H](C)CC[C@@H]3[C@]3(C=O)C[C@H]1C=C(C(C)C)[C@]23C(=O)O |
| InChI | InChI=1S/C30H48O4/c1-5-6-7-8-9-10-11-12-15-34-20-29-18-24-22(4)13-14-25(24)28(19-31)17-23(29)16-26(21(2)3)30(28,29)27(32)33/h16,19,21-25H,5-15,17-18,20H2,1-4H3,(H,32,33)/t22-,23+,24-,25-,28+,29+,30+/m0/s1 |
| InChIKey | GFJRJHLMIRSRCF-VGFQTSTPSA-N |
| XLogP | 7.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|