C26H39FO4 — CID 101209585
(1R,2S,4S,5S,6R,8R,9S,11R)-6-fluoro-9-formyl-2-(hexoxymethyl)-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 101209585) has the molecular formula C26H39FO4 and a molecular weight of 434.59 g/mol. Its IUPAC name is (1R,2S,4S,5S,6R,8R,9S,11R)-6-fluoro-9-formyl-2-(hexoxymethyl)-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | (1R,2S,4S,5S,6R,8R,9S,11R)-6-fluoro-9-formyl-2-(hexoxymethyl)-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 101209585 |
| Molecular Formula | C26H39FO4 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | (1R,2S,4S,5S,6R,8R,9S,11R)-6-fluoro-9-formyl-2-(hexoxymethyl)-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CCCCCCOC[C@@]12C[C@@H]3[C@H](C)[C@H](F)C[C@H]3[C@@]3(C=O)C[C@@H]1C=C(C(C)C)[C@@]23C(=O)O |
| InChI | InChI=1S/C26H39FO4/c1-5-6-7-8-9-31-15-25-13-19-17(4)22(27)11-21(19)24(14-28)12-18(25)10-20(16(2)3)26(24,25)23(29)30/h10,14,16-19,21-22H,5-9,11-13,15H2,1-4H3,(H,29,30)/t17-,18-,19+,21+,22+,24-,25-,26-/m0/s1 |
| InChIKey | KNQOBWUXXIJEBX-JROUWLBMSA-N |
| XLogP | 5.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|