C22H42O6 — CID 57101682
decyl 2-[4-[(1S,2R)-3,5-dihydroxy-2-(hydroxymethyl)cyclopentyl]butoxy]acetate (PubChem CID 57101682) has the molecular formula C22H42O6 and a molecular weight of 402.57 g/mol. Its IUPAC name is decyl 2-[4-[(1S,2R)-3,5-dihydroxy-2-(hydroxymethyl)cyclopentyl]butoxy]acetate.
| Compound Name | decyl 2-[4-[(1S,2R)-3,5-dihydroxy-2-(hydroxymethyl)cyclopentyl]butoxy]acetate |
|---|---|
| PubChem CID | 57101682 |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | decyl 2-[4-[(1S,2R)-3,5-dihydroxy-2-(hydroxymethyl)cyclopentyl]butoxy]acetate |
| SMILES | CCCCCCCCCCOC(=O)COCCCC[C@@H]1C(O)CC(O)[C@H]1CO |
| InChI | InChI=1S/C22H42O6/c1-2-3-4-5-6-7-8-10-14-28-22(26)17-27-13-11-9-12-18-19(16-23)21(25)15-20(18)24/h18-21,23-25H,2-17H2,1H3/t18-,19-,20?,21?/m0/s1 |
| InChIKey | PPUPJAKJKCGTBG-IKJYFWGWSA-N |
| XLogP | 3.21 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|