C21H37NO5 — CID 57102499
ethyl 3-[(3-ethyl-8,8,9,10,10-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]prop-2-enoate (PubChem CID 57102499) has the molecular formula C21H37NO5 and a molecular weight of 383.53 g/mol. Its IUPAC name is ethyl 3-[(3-ethyl-8,8,9,10,10-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]prop-2-enoate.
| Compound Name | ethyl 3-[(3-ethyl-8,8,9,10,10-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]prop-2-enoate |
|---|---|
| PubChem CID | 57102499 |
| Molecular Formula | C21H37NO5 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | ethyl 3-[(3-ethyl-8,8,9,10,10-pentamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]prop-2-enoate |
| SMILES | CCOC(=O)C=COCC1(CC)COC2(CC(C)(C)N(C)C(C)(C)C2)OC1 |
| InChI | InChI=1S/C21H37NO5/c1-8-20(14-24-11-10-17(23)25-9-2)15-26-21(27-16-20)12-18(3,4)22(7)19(5,6)13-21/h10-11H,8-9,12-16H2,1-7H3 |
| InChIKey | NWKADXLRXFKNRW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|