C35H62N2O4 — CID 135254039
3-[(1E,6E)-7-(3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)hepta-1,6-dienyl]-3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 135254039) has the molecular formula C35H62N2O4 and a molecular weight of 574.89 g/mol. Its IUPAC name is 3-[(1E,6E)-7-(3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)hepta-1,6-dienyl]-3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 3-[(1E,6E)-7-(3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)hepta-1,6-dienyl]-3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 135254039 |
| Molecular Formula | C35H62N2O4 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.47 |
| IUPAC Name | 3-[(1E,6E)-7-(3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)hepta-1,6-dienyl]-3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)OCC(C)(/C=C/CCC/C=C/C1(C)COC3(CC(C)(C)N(C)C(C)(C)C3)OC1)CO2 |
| InChI | InChI=1S/C35H62N2O4/c1-28(2)20-34(21-29(3,4)36(28)11)38-24-32(9,25-39-34)18-16-14-13-15-17-19-33(10)26-40-35(41-27-33)22-30(5,6)37(12)31(7,8)23-35/h16-19H,13-15,20-27H2,1-12H3/b18-16+,19-17+ |
| InChIKey | FROIWONRSMETIS-YWNVXTCZSA-N |
| XLogP | 7.33 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|