C17H33NO3 — CID 135254028
3,8,8,9,10,10-hexamethyl-3-propoxy-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 135254028) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 3,8,8,9,10,10-hexamethyl-3-propoxy-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 3,8,8,9,10,10-hexamethyl-3-propoxy-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 135254028 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 3,8,8,9,10,10-hexamethyl-3-propoxy-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CCCOC1(C)COC2(CC(C)(C)N(C)C(C)(C)C2)OC1 |
| InChI | InChI=1S/C17H33NO3/c1-8-9-19-16(6)12-20-17(21-13-16)10-14(2,3)18(7)15(4,5)11-17/h8-13H2,1-7H3 |
| InChIKey | NKHJEKQVSSJDBM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |