C33H62N2O6 — CID 135254050
3-[5-[(3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methoxy]pentoxymethyl]-3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 135254050) has the molecular formula C33H62N2O6 and a molecular weight of 582.87 g/mol. Its IUPAC name is 3-[5-[(3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methoxy]pentoxymethyl]-3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 3-[5-[(3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methoxy]pentoxymethyl]-3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 135254050 |
| Molecular Formula | C33H62N2O6 |
| Molecular Weight | 582.87 g/mol |
| Exact Mass | 582.46 |
| IUPAC Name | 3-[5-[(3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methoxy]pentoxymethyl]-3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)OCC(C)(COCCCCCOCC1(C)COC3(CC(C)(C)N(C)C(C)(C)C3)O1)O2 |
| InChI | InChI=1S/C33H62N2O6/c1-26(2)18-32(19-27(3,4)34(26)11)38-24-30(9,40-32)22-36-16-14-13-15-17-37-23-31(10)25-39-33(41-31)20-28(5,6)35(12)29(7,8)21-33/h13-25H2,1-12H3 |
| InChIKey | JLFGPOYHWWKFJV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.87 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|