C13H15BrN2O3S — CID 57103301
(6S,7R)-3-(bromomethyl)-7-(cyclopentylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57103301) has the molecular formula C13H15BrN2O3S and a molecular weight of 359.25 g/mol. Its IUPAC name is (6S,7R)-3-(bromomethyl)-7-(cyclopentylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(bromomethyl)-7-(cyclopentylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57103301 |
| Molecular Formula | C13H15BrN2O3S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (6S,7R)-3-(bromomethyl)-7-(cyclopentylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(CBr)CS[C@H]2[C@H](N=C3CCCC3)C(=O)N12 |
| InChI | InChI=1S/C13H15BrN2O3S/c14-5-7-6-20-12-9(15-8-3-1-2-4-8)11(17)16(12)10(7)13(18)19/h9,12H,1-6H2,(H,18,19)/t9-,12+/m1/s1 |
| InChIKey | VVUKMTCHLSYOSS-SKDRFNHKSA-N |
| XLogP | 2.02 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|