About (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite
(2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite (PubChem CID 57104673) has the molecular formula C10H19N3O6
and a molecular weight of 277.28 g/mol. Its IUPAC name is (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite.
Molecular Properties
| Compound Name | (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite |
| PubChem CID | 57104673 |
| Molecular Formula | C10H19N3O6 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite |
| SMILES | CC(CON=O)CC(CCCCCON=O)ON=O |
| InChI | InChI=1S/C10H19N3O6/c1-9(8-18-12-15)7-10(19-13-16)5-3-2-4-6-17-11-14/h9-10H,2-8H2,1H3 |
| InChIKey | BOYXXVSEVSOIOC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite?
The IUPAC name of (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite (CID 57104673) is (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite.
What is the SMILES notation for (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite?
The canonical SMILES for (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite is CC(CON=O)CC(CCCCCON=O)ON=O.
What is the InChIKey of (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite?
The InChIKey is BOYXXVSEVSOIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O6/c1-9(8-18-12-15)7-10(19-13-16)5-3-2-4-6-17-11-14/h9-10H,2-8H2,1H3.
What are the key properties of (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite?
(2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite has a molecular weight of 277.28 g/mol, XLogP of 3.04, 14 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,9-dinitrosooxynonan-4-yl) nitrite is sourced from PubChem (CID 57104673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).