About 2-methylbutyl nitrite;3-methylbutyl nitrite
2-methylbutyl nitrite;3-methylbutyl nitrite (PubChem CID 24687) has the molecular formula C10H22N2O4
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-methylbutyl nitrite;3-methylbutyl nitrite.
Molecular Properties
| Compound Name | 2-methylbutyl nitrite;3-methylbutyl nitrite |
| PubChem CID | 24687 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-methylbutyl nitrite;3-methylbutyl nitrite |
| SMILES | CC(C)CCON=O.CCC(C)CON=O |
| InChI | InChI=1S/2C5H11NO2/c1-5(2)3-4-8-6-7;1-3-5(2)4-8-6-7/h2*5H,3-4H2,1-2H3 |
| InChIKey | XNCKCDBPEMSUFA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutyl nitrite;3-methylbutyl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl nitrite;3-methylbutyl nitrite?
The IUPAC name of 2-methylbutyl nitrite;3-methylbutyl nitrite (CID 24687) is 2-methylbutyl nitrite;3-methylbutyl nitrite.
What is the SMILES notation for 2-methylbutyl nitrite;3-methylbutyl nitrite?
The canonical SMILES for 2-methylbutyl nitrite;3-methylbutyl nitrite is CC(C)CCON=O.CCC(C)CON=O.
What is the InChIKey of 2-methylbutyl nitrite;3-methylbutyl nitrite?
The InChIKey is XNCKCDBPEMSUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11NO2/c1-5(2)3-4-8-6-7;1-3-5(2)4-8-6-7/h2*5H,3-4H2,1-2H3.
What are the key properties of 2-methylbutyl nitrite;3-methylbutyl nitrite?
2-methylbutyl nitrite;3-methylbutyl nitrite has a molecular weight of 234.30 g/mol, XLogP of 3.46, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl nitrite;3-methylbutyl nitrite is sourced from PubChem (CID 24687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).