C28H26N2O4 — CID 57108115
2-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-dimethyl-3-[3-(2-oxoethoxy)phenyl]propanamide (PubChem CID 57108115) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-dimethyl-3-[3-(2-oxoethoxy)phenyl]propanamide.
| Compound Name | 2-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-dimethyl-3-[3-(2-oxoethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 57108115 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-dimethyl-3-[3-(2-oxoethoxy)phenyl]propanamide |
| SMILES | CN(C)C(=O)C(Cc1cccc(OCC=O)c1)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C28H26N2O4/c1-30(2)28(32)24(19-20-10-9-15-23(18-20)33-17-16-31)27-29-25(21-11-5-3-6-12-21)26(34-27)22-13-7-4-8-14-22/h3-16,18,24H,17,19H2,1-2H3 |
| InChIKey | FEWODZARCIHJEG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|