C17H22N4O3 — CID 57109264
[4-[[[(3-methyl-1,3-oxazolidin-2-ylidene)amino]-pyrrolidin-1-ylmethylidene]amino]phenyl] acetate (PubChem CID 57109264) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is [4-[[[(3-methyl-1,3-oxazolidin-2-ylidene)amino]-pyrrolidin-1-ylmethylidene]amino]phenyl] acetate.
| Compound Name | [4-[[[(3-methyl-1,3-oxazolidin-2-ylidene)amino]-pyrrolidin-1-ylmethylidene]amino]phenyl] acetate |
|---|---|
| PubChem CID | 57109264 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [4-[[[(3-methyl-1,3-oxazolidin-2-ylidene)amino]-pyrrolidin-1-ylmethylidene]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/N=C(\N=C2OCCN2C)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H22N4O3/c1-13(22)24-15-7-5-14(6-8-15)18-16(21-9-3-4-10-21)19-17-20(2)11-12-23-17/h5-8H,3-4,9-12H2,1-2H3/b18-16+,19-17? |
| InChIKey | WSIGYYFHRIWHHD-LDZSMDDMSA-N |
| XLogP | 2.01 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|