C16H21IN4O3S — CID 70529212
N'-(1,3-benzodioxol-5-yl)-N-(3-methyl-1,3-thiazolidin-2-ylidene)morpholine-4-carboximidamide;hydroiodide (PubChem CID 70529212) has the molecular formula C16H21IN4O3S and a molecular weight of 476.34 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-(3-methyl-1,3-thiazolidin-2-ylidene)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-(3-methyl-1,3-thiazolidin-2-ylidene)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 70529212 |
| Molecular Formula | C16H21IN4O3S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-(3-methyl-1,3-thiazolidin-2-ylidene)morpholine-4-carboximidamide;hydroiodide |
| SMILES | CN1CCSC1=N/C(=N\c1ccc2c(c1)OCO2)N1CCOCC1.I |
| InChI | InChI=1S/C16H20N4O3S.HI/c1-19-6-9-24-16(19)18-15(20-4-7-21-8-5-20)17-12-2-3-13-14(10-12)23-11-22-13;/h2-3,10H,4-9,11H2,1H3;1H/b17-15+,18-16?; |
| InChIKey | YXVNUNUMELBCPK-AMZTUCSTSA-N |
| XLogP | 2.39 |
| TPSA | 58.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|