C25H28O8 — CID 57109628
3-(7-methyloctoxycarbonyl)-5-phenylbenzene-1,2,4-tricarboxylic acid (PubChem CID 57109628) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is 3-(7-methyloctoxycarbonyl)-5-phenylbenzene-1,2,4-tricarboxylic acid.
| Compound Name | 3-(7-methyloctoxycarbonyl)-5-phenylbenzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 57109628 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-(7-methyloctoxycarbonyl)-5-phenylbenzene-1,2,4-tricarboxylic acid |
| SMILES | CC(C)CCCCCCOC(=O)c1c(C(=O)O)c(C(=O)O)cc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C25H28O8/c1-15(2)10-6-3-4-9-13-33-25(32)21-19(23(28)29)17(16-11-7-5-8-12-16)14-18(22(26)27)20(21)24(30)31/h5,7-8,11-12,14-15H,3-4,6,9-10,13H2,1-2H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | ZPGXBEWKEZLBRF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|