C20H18ClFN2O2 — CID 57109869
5-[2-(5-but-2-enyl-1,3-dioxan-2-yl)ethynyl]-2-(4-chloro-3-fluorophenyl)pyrimidine (PubChem CID 57109869) has the molecular formula C20H18ClFN2O2 and a molecular weight of 372.83 g/mol. Its IUPAC name is 5-[2-(5-but-2-enyl-1,3-dioxan-2-yl)ethynyl]-2-(4-chloro-3-fluorophenyl)pyrimidine.
| Compound Name | 5-[2-(5-but-2-enyl-1,3-dioxan-2-yl)ethynyl]-2-(4-chloro-3-fluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 57109869 |
| Molecular Formula | C20H18ClFN2O2 |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 5-[2-(5-but-2-enyl-1,3-dioxan-2-yl)ethynyl]-2-(4-chloro-3-fluorophenyl)pyrimidine |
| SMILES | CC=CCC1COC(C#Cc2cnc(-c3ccc(Cl)c(F)c3)nc2)OC1 |
| InChI | InChI=1S/C20H18ClFN2O2/c1-2-3-4-15-12-25-19(26-13-15)8-5-14-10-23-20(24-11-14)16-6-7-17(21)18(22)9-16/h2-3,6-7,9-11,15,19H,4,12-13H2,1H3 |
| InChIKey | ABEIQFHJDFRBMB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|