C12H20O3 — CID 57111795
1-(2-cyclohexyl-1,3-dioxolan-2-yl)propan-1-one (PubChem CID 57111795) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(2-cyclohexyl-1,3-dioxolan-2-yl)propan-1-one.
| Compound Name | 1-(2-cyclohexyl-1,3-dioxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 57111795 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-(2-cyclohexyl-1,3-dioxolan-2-yl)propan-1-one |
| SMILES | CCC(=O)C1(C2CCCCC2)OCCO1 |
| InChI | InChI=1S/C12H20O3/c1-2-11(13)12(14-8-9-15-12)10-6-4-3-5-7-10/h10H,2-9H2,1H3 |
| InChIKey | HHNSDBPZWNJHPR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |