C20H30O3 — CID 57112847
(3R,4aS,5S,10aR,10bR)-3-ethenyl-5-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,8,9,10,10b-hexahydrobenzo[f]chromen-1-one (PubChem CID 57112847) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3R,4aS,5S,10aR,10bR)-3-ethenyl-5-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,8,9,10,10b-hexahydrobenzo[f]chromen-1-one.
| Compound Name | (3R,4aS,5S,10aR,10bR)-3-ethenyl-5-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,8,9,10,10b-hexahydrobenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 57112847 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3R,4aS,5S,10aR,10bR)-3-ethenyl-5-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,8,9,10,10b-hexahydrobenzo[f]chromen-1-one |
| SMILES | C=C[C@@]1(C)CC(=O)[C@H]2[C@](C)(O1)[C@@H](O)C=C1C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C20H30O3/c1-7-18(4)12-13(21)16-19(5)10-8-9-17(2,3)14(19)11-15(22)20(16,6)23-18/h7,11,15-16,22H,1,8-10,12H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 |
| InChIKey | PIHDVRFAXTUEBG-HHUCQEJWSA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|