About 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane
1-cyclohexyl-4-hexa-1,5-dienylcyclohexane (PubChem CID 57115244) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane |
| PubChem CID | 57115244 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane |
| SMILES | C=CCCC=CC1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H30/c1-2-3-4-6-9-16-12-14-18(15-13-16)17-10-7-5-8-11-17/h2,6,9,16-18H,1,3-5,7-8,10-15H2 |
| InChIKey | PMGZLORCOBGPGA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane?
The IUPAC name of 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane (CID 57115244) is 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane.
What is the SMILES notation for 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane?
The canonical SMILES for 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane is C=CCCC=CC1CCC(C2CCCCC2)CC1.
What is the InChIKey of 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane?
The InChIKey is PMGZLORCOBGPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30/c1-2-3-4-6-9-16-12-14-18(15-13-16)17-10-7-5-8-11-17/h2,6,9,16-18H,1,3-5,7-8,10-15H2.
What are the key properties of 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane?
1-cyclohexyl-4-hexa-1,5-dienylcyclohexane has a molecular weight of 246.44 g/mol, XLogP of 5.90, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane is sourced from PubChem (CID 57115244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).