C18H30 — CID 57115244
1-cyclohexyl-4-hexa-1,5-dienylcyclohexane (PubChem CID 57115244) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane.
| Compound Name | 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane |
|---|---|
| PubChem CID | 57115244 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1-cyclohexyl-4-hexa-1,5-dienylcyclohexane |
| SMILES | C=CCCC=CC1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H30/c1-2-3-4-6-9-16-12-14-18(15-13-16)17-10-7-5-8-11-17/h2,6,9,16-18H,1,3-5,7-8,10-15H2 |
| InChIKey | PMGZLORCOBGPGA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|