C21H33F3 — CID 89134859
1-ethenyl-4-[4-[(E)-7,7,7-trifluorohept-1-enyl]cyclohexyl]cyclohexane (PubChem CID 89134859) has the molecular formula C21H33F3 and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-ethenyl-4-[4-[(E)-7,7,7-trifluorohept-1-enyl]cyclohexyl]cyclohexane.
| Compound Name | 1-ethenyl-4-[4-[(E)-7,7,7-trifluorohept-1-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 89134859 |
| Molecular Formula | C21H33F3 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 1-ethenyl-4-[4-[(E)-7,7,7-trifluorohept-1-enyl]cyclohexyl]cyclohexane |
| SMILES | C=CC1CCC(C2CCC(/C=C/CCCCC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C21H33F3/c1-2-17-8-12-19(13-9-17)20-14-10-18(11-15-20)7-5-3-4-6-16-21(22,23)24/h2,5,7,17-20H,1,3-4,6,8-16H2/b7-5+ |
| InChIKey | JXHPPAIJJFXVJA-FNORWQNLSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|