C16H25N5O3 — CID 57119029
7-(4-nitrophenyl)-1,4,8,11-tetrazacyclotetradecan-5-one (PubChem CID 57119029) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-1,4,8,11-tetrazacyclotetradecan-5-one.
| Compound Name | 7-(4-nitrophenyl)-1,4,8,11-tetrazacyclotetradecan-5-one |
|---|---|
| PubChem CID | 57119029 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 7-(4-nitrophenyl)-1,4,8,11-tetrazacyclotetradecan-5-one |
| SMILES | O=C1CC(c2ccc([N+](=O)[O-])cc2)NCCNCCCNCCN1 |
| InChI | InChI=1S/C16H25N5O3/c22-16-12-15(13-2-4-14(5-3-13)21(23)24)19-10-8-17-6-1-7-18-9-11-20-16/h2-5,15,17-19H,1,6-12H2,(H,20,22) |
| InChIKey | IKZPGSCDHVFSKY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|