C14H20N6O2S2 — CID 57123655
1-(1H-imidazol-2-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropane-1-thiol (PubChem CID 57123655) has the molecular formula C14H20N6O2S2 and a molecular weight of 368.49 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropane-1-thiol.
| Compound Name | 1-(1H-imidazol-2-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropane-1-thiol |
|---|---|
| PubChem CID | 57123655 |
| Molecular Formula | C14H20N6O2S2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-(1H-imidazol-2-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropane-1-thiol |
| SMILES | O=S(=O)(CCC(S)c1ncc[nH]1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H20N6O2S2/c21-24(22,11-2-12(23)13-15-5-6-16-13)20-9-7-19(8-10-20)14-17-3-1-4-18-14/h1,3-6,12,23H,2,7-11H2,(H,15,16) |
| InChIKey | DGSJIZJNICIEDW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|